C13H23NO6S — CID 91335584
ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonylpent-4-enoate (PubChem CID 91335584) has the molecular formula C13H23NO6S and a molecular weight of 321.40 g/mol. Its IUPAC name is ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonylpent-4-enoate.
| Compound Name | ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonylpent-4-enoate |
|---|---|
| PubChem CID | 91335584 |
| Molecular Formula | C13H23NO6S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonylpent-4-enoate |
| SMILES | CCOC(=O)CC(C=CS(C)(=O)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO6S/c1-6-19-11(15)9-10(7-8-21(5,17)18)14-12(16)20-13(2,3)4/h7-8,10H,6,9H2,1-5H3,(H,14,16) |
| InChIKey | JWAXITABQGIDKN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |