C18H18N4O2 — CID 91335599
3-amino-N-[2-(2-methylpropanoyl)imidazo[1,2-a]pyridin-6-yl]benzamide (PubChem CID 91335599) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 3-amino-N-[2-(2-methylpropanoyl)imidazo[1,2-a]pyridin-6-yl]benzamide.
| Compound Name | 3-amino-N-[2-(2-methylpropanoyl)imidazo[1,2-a]pyridin-6-yl]benzamide |
|---|---|
| PubChem CID | 91335599 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-amino-N-[2-(2-methylpropanoyl)imidazo[1,2-a]pyridin-6-yl]benzamide |
| SMILES | CC(C)C(=O)c1cn2cc(NC(=O)c3cccc(N)c3)ccc2n1 |
| InChI | InChI=1S/C18H18N4O2/c1-11(2)17(23)15-10-22-9-14(6-7-16(22)21-15)20-18(24)12-4-3-5-13(19)8-12/h3-11H,19H2,1-2H3,(H,20,24) |
| InChIKey | QILFXLVWSPEXJY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|