C14H19NO7 — CID 91335893
1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxyethyl cyclohexanecarboxylate (PubChem CID 91335893) has the molecular formula C14H19NO7 and a molecular weight of 313.31 g/mol. Its IUPAC name is 1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxyethyl cyclohexanecarboxylate.
| Compound Name | 1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxyethyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 91335893 |
| Molecular Formula | C14H19NO7 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxyethyl cyclohexanecarboxylate |
| SMILES | CC(OC(=O)On1c(O)ccc1O)OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C14H19NO7/c1-9(20-13(18)10-5-3-2-4-6-10)21-14(19)22-15-11(16)7-8-12(15)17/h7-10,16-17H,2-6H2,1H3 |
| InChIKey | DRXJHGCHUBOTGK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|