C15H14FN5O2S — CID 91337023
2-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-5-methylsulfonylpyrimidin-4-amine (PubChem CID 91337023) has the molecular formula C15H14FN5O2S and a molecular weight of 347.38 g/mol. Its IUPAC name is 2-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-5-methylsulfonylpyrimidin-4-amine.
| Compound Name | 2-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-5-methylsulfonylpyrimidin-4-amine |
|---|---|
| PubChem CID | 91337023 |
| Molecular Formula | C15H14FN5O2S |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-5-methylsulfonylpyrimidin-4-amine |
| SMILES | CS(=O)(=O)c1cnc(-c2ccn(Cc3ccccc3F)n2)nc1N |
| InChI | InChI=1S/C15H14FN5O2S/c1-24(22,23)13-8-18-15(19-14(13)17)12-6-7-21(20-12)9-10-4-2-3-5-11(10)16/h2-8H,9H2,1H3,(H2,17,18,19) |
| InChIKey | JVJOPUGSKGFWOV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |