C20H22FN5O — CID 90991851
5-cyclopropyl-N-(ethoxymethyl)-2-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]pyrimidin-4-amine (PubChem CID 90991851) has the molecular formula C20H22FN5O and a molecular weight of 367.43 g/mol. Its IUPAC name is 5-cyclopropyl-N-(ethoxymethyl)-2-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]pyrimidin-4-amine.
| Compound Name | 5-cyclopropyl-N-(ethoxymethyl)-2-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 90991851 |
| Molecular Formula | C20H22FN5O |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 5-cyclopropyl-N-(ethoxymethyl)-2-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]pyrimidin-4-amine |
| SMILES | CCOCNc1nc(-c2ccn(Cc3ccccc3F)n2)ncc1C1CC1 |
| InChI | InChI=1S/C20H22FN5O/c1-2-27-13-23-19-16(14-7-8-14)11-22-20(24-19)18-9-10-26(25-18)12-15-5-3-4-6-17(15)21/h3-6,9-11,14H,2,7-8,12-13H2,1H3,(H,22,23,24) |
| InChIKey | USSLWEOLBRNKCN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|