C25H20N2O7S — CID 91340049
4-[[6-[benzyl(sulfo)carbamoyl]-2-oxo-1H-quinolin-3-yl]methyl]benzoic acid (PubChem CID 91340049) has the molecular formula C25H20N2O7S and a molecular weight of 492.51 g/mol. Its IUPAC name is 4-[[6-[benzyl(sulfo)carbamoyl]-2-oxo-1H-quinolin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[6-[benzyl(sulfo)carbamoyl]-2-oxo-1H-quinolin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 91340049 |
| Molecular Formula | C25H20N2O7S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 4-[[6-[benzyl(sulfo)carbamoyl]-2-oxo-1H-quinolin-3-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cc2cc3cc(C(=O)N(Cc4ccccc4)S(=O)(=O)O)ccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C25H20N2O7S/c28-23-21(12-16-6-8-18(9-7-16)25(30)31)14-20-13-19(10-11-22(20)26-23)24(29)27(35(32,33)34)15-17-4-2-1-3-5-17/h1-11,13-14H,12,15H2,(H,26,28)(H,30,31)(H,32,33,34) |
| InChIKey | AURADIQDLFQTGZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 144.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|