C10H14N4O5 — CID 91341012
(2S)-2-[2-(4-amino-2-oxopyrimidin-1-yl)propanoylamino]-3-hydroxypropanoic acid (PubChem CID 91341012) has the molecular formula C10H14N4O5 and a molecular weight of 270.25 g/mol. Its IUPAC name is (2S)-2-[2-(4-amino-2-oxopyrimidin-1-yl)propanoylamino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[2-(4-amino-2-oxopyrimidin-1-yl)propanoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 91341012 |
| Molecular Formula | C10H14N4O5 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (2S)-2-[2-(4-amino-2-oxopyrimidin-1-yl)propanoylamino]-3-hydroxypropanoic acid |
| SMILES | CC(C(=O)N[C@@H](CO)C(=O)O)n1ccc(N)nc1=O |
| InChI | InChI=1S/C10H14N4O5/c1-5(8(16)12-6(4-15)9(17)18)14-3-2-7(11)13-10(14)19/h2-3,5-6,15H,4H2,1H3,(H,12,16)(H,17,18)(H2,11,13,19)/t5?,6-/m0/s1 |
| InChIKey | OFPAKVNSIYILAS-GDVGLLTNSA-N |
| XLogP | -2.05 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |