C11H17N5O5 — CID 174229698
2-[2-aminoethyl-[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]-3-hydroxypropanoic acid (PubChem CID 174229698) has the molecular formula C11H17N5O5 and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-[2-aminoethyl-[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[2-aminoethyl-[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 174229698 |
| Molecular Formula | C11H17N5O5 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[2-aminoethyl-[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]-3-hydroxypropanoic acid |
| SMILES | NCCN(C(=O)Cn1ccc(N)nc1=O)C(CO)C(=O)O |
| InChI | InChI=1S/C11H17N5O5/c12-2-4-16(7(6-17)10(19)20)9(18)5-15-3-1-8(13)14-11(15)21/h1,3,7,17H,2,4-6,12H2,(H,19,20)(H2,13,14,21) |
| InChIKey | YAHJUCRVJWTMMV-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 164.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |