C9H11N3O5 — CID 43357744
3-hydroxy-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]propanoic acid (PubChem CID 43357744) has the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. Its IUPAC name is 3-hydroxy-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]propanoic acid.
| Compound Name | 3-hydroxy-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43357744 |
| Molecular Formula | C9H11N3O5 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 3-hydroxy-2-[[2-(2-oxopyrimidin-1-yl)acetyl]amino]propanoic acid |
| SMILES | O=C(Cn1cccnc1=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C9H11N3O5/c13-5-6(8(15)16)11-7(14)4-12-3-1-2-10-9(12)17/h1-3,6,13H,4-5H2,(H,11,14)(H,15,16) |
| InChIKey | OKLNZCJWYJAEEX-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |