C25H40N2O2 — CID 91341377
5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-N-butyl-N-(cyclohexa-1,5-dien-1-ylmethyl)-5-oxopentanamide (PubChem CID 91341377) has the molecular formula C25H40N2O2 and a molecular weight of 400.61 g/mol. Its IUPAC name is 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-N-butyl-N-(cyclohexa-1,5-dien-1-ylmethyl)-5-oxopentanamide.
| Compound Name | 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-N-butyl-N-(cyclohexa-1,5-dien-1-ylmethyl)-5-oxopentanamide |
|---|---|
| PubChem CID | 91341377 |
| Molecular Formula | C25H40N2O2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-N-butyl-N-(cyclohexa-1,5-dien-1-ylmethyl)-5-oxopentanamide |
| SMILES | CCCCN(CC1=CCCC=C1)C(=O)CCCC(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C25H40N2O2/c1-2-3-18-26(20-21-11-5-4-6-12-21)24(28)16-9-17-25(29)27-19-10-14-22-13-7-8-15-23(22)27/h5,11-12,22-23H,2-4,6-10,13-20H2,1H3 |
| InChIKey | KNPVBMKIUJHNIK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |