About (Z)-prop-1-en-1-amine;N-[(Z)-prop-1-enyl]acetamide
(Z)-prop-1-en-1-amine;N-[(Z)-prop-1-enyl]acetamide (PubChem CID 91341676) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is (Z)-prop-1-en-1-amine;N-[(Z)-prop-1-enyl]acetamide.
Molecular Properties
| Compound Name | (Z)-prop-1-en-1-amine;N-[(Z)-prop-1-enyl]acetamide |
| PubChem CID | 91341676 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (Z)-prop-1-en-1-amine;N-[(Z)-prop-1-enyl]acetamide |
| SMILES | C/C=C\N.C/C=C\NC(C)=O |
| InChI | InChI=1S/C5H9NO.C3H7N/c1-3-4-6-5(2)7;1-2-3-4/h3-4H,1-2H3,(H,6,7);2-3H,4H2,1H3/b4-3-;3-2- |
| InChIKey | RRIJOSFTTFVPAB-DLEFDPBHSA-N |
| XLogP | 1.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-prop-1-en-1-amine;N-[(Z)-prop-1-enyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-prop-1-en-1-amine;N-[(Z)-prop-1-enyl]acetamide?
The IUPAC name of (Z)-prop-1-en-1-amine;N-[(Z)-prop-1-enyl]acetamide (CID 91341676) is (Z)-prop-1-en-1-amine;N-[(Z)-prop-1-enyl]acetamide.
What is the SMILES notation for (Z)-prop-1-en-1-amine;N-[(Z)-prop-1-enyl]acetamide?
The canonical SMILES for (Z)-prop-1-en-1-amine;N-[(Z)-prop-1-enyl]acetamide is C/C=C\N.C/C=C\NC(C)=O.
What is the InChIKey of (Z)-prop-1-en-1-amine;N-[(Z)-prop-1-enyl]acetamide?
The InChIKey is RRIJOSFTTFVPAB-DLEFDPBHSA-N. The full InChI is InChI=1S/C5H9NO.C3H7N/c1-3-4-6-5(2)7;1-2-3-4/h3-4H,1-2H3,(H,6,7);2-3H,4H2,1H3/b4-3-;3-2-.
What are the key properties of (Z)-prop-1-en-1-amine;N-[(Z)-prop-1-enyl]acetamide?
(Z)-prop-1-en-1-amine;N-[(Z)-prop-1-enyl]acetamide has a molecular weight of 156.23 g/mol, XLogP of 1.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-prop-1-en-1-amine;N-[(Z)-prop-1-enyl]acetamide is sourced from PubChem (CID 91341676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).