C33H51O4P — CID 91342077
11-hydroxy-1,3,7,9-tetrapentyl-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide (PubChem CID 91342077) has the molecular formula C33H51O4P and a molecular weight of 542.74 g/mol. Its IUPAC name is 11-hydroxy-1,3,7,9-tetrapentyl-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide.
| Compound Name | 11-hydroxy-1,3,7,9-tetrapentyl-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
|---|---|
| PubChem CID | 91342077 |
| Molecular Formula | C33H51O4P |
| Molecular Weight | 542.74 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | 11-hydroxy-1,3,7,9-tetrapentyl-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
| SMILES | CCCCCc1cc(CCCCC)c2c(c1)Cc1cc(CCCCC)cc(CCCCC)c1OP(=O)(O)O2 |
| InChI | InChI=1S/C33H51O4P/c1-5-9-13-17-26-21-28(19-15-11-7-3)32-30(23-26)25-31-24-27(18-14-10-6-2)22-29(20-16-12-8-4)33(31)37-38(34,35)36-32/h21-24H,5-20,25H2,1-4H3,(H,34,35) |
| InChIKey | OHFRDKOTUWZVLT-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.74 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|