C22H21F2N3O — CID 91342617
[3-(2,6-difluoro-3-pyridinyl)-2-azabicyclo[3.2.1]oct-3-en-2-yl]-(3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 91342617) has the molecular formula C22H21F2N3O and a molecular weight of 381.43 g/mol. Its IUPAC name is [3-(2,6-difluoro-3-pyridinyl)-2-azabicyclo[3.2.1]oct-3-en-2-yl]-(3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | [3-(2,6-difluoro-3-pyridinyl)-2-azabicyclo[3.2.1]oct-3-en-2-yl]-(3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 91342617 |
| Molecular Formula | C22H21F2N3O |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | [3-(2,6-difluoro-3-pyridinyl)-2-azabicyclo[3.2.1]oct-3-en-2-yl]-(3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | O=C(N1CCCc2ccccc21)N1C(c2ccc(F)nc2F)=CC2CCC1C2 |
| InChI | InChI=1S/C22H21F2N3O/c23-20-10-9-17(21(24)25-20)19-13-14-7-8-16(12-14)27(19)22(28)26-11-3-5-15-4-1-2-6-18(15)26/h1-2,4,6,9-10,13-14,16H,3,5,7-8,11-12H2 |
| InChIKey | AUYXTRAZZLOCST-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|