About 4a,5,6,7-tetrahydro-4H-cyclopenta[c]pyridazine
4a,5,6,7-tetrahydro-4H-cyclopenta[c]pyridazine (PubChem CID 91343493) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 4a,5,6,7-tetrahydro-4H-cyclopenta[c]pyridazine.
Analyze 4a,5,6,7-tetrahydro-4H-cyclopenta[c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,5,6,7-tetrahydro-4H-cyclopenta[c]pyridazine?
The IUPAC name of 4a,5,6,7-tetrahydro-4H-cyclopenta[c]pyridazine (CID 91343493) is 4a,5,6,7-tetrahydro-4H-cyclopenta[c]pyridazine.
What is the SMILES notation for 4a,5,6,7-tetrahydro-4H-cyclopenta[c]pyridazine?
The canonical SMILES for 4a,5,6,7-tetrahydro-4H-cyclopenta[c]pyridazine is C1=NN=C2CCCC2C1.
What is the InChIKey of 4a,5,6,7-tetrahydro-4H-cyclopenta[c]pyridazine?
The InChIKey is PYEBBROWPJOEJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-2-6-4-5-8-9-7(6)3-1/h5-6H,1-4H2.
What are the key properties of 4a,5,6,7-tetrahydro-4H-cyclopenta[c]pyridazine?
4a,5,6,7-tetrahydro-4H-cyclopenta[c]pyridazine has a molecular weight of 122.17 g/mol, XLogP of 1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,5,6,7-tetrahydro-4H-cyclopenta[c]pyridazine is sourced from PubChem (CID 91343493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).