C20H20N2O2 — CID 91344944
6-(3-aminophenyl)-3-benzyl-6-ethyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol (PubChem CID 91344944) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 6-(3-aminophenyl)-3-benzyl-6-ethyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol.
| Compound Name | 6-(3-aminophenyl)-3-benzyl-6-ethyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
|---|---|
| PubChem CID | 91344944 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 6-(3-aminophenyl)-3-benzyl-6-ethyl-3-azabicyclo[3.1.0]hexa-1,4-diene-2,4-diol |
| SMILES | CCC1(c2cccc(N)c2)c2c1c(O)n(Cc1ccccc1)c2O |
| InChI | InChI=1S/C20H20N2O2/c1-2-20(14-9-6-10-15(21)11-14)16-17(20)19(24)22(18(16)23)12-13-7-4-3-5-8-13/h3-11,23-24H,2,12,21H2,1H3 |
| InChIKey | NLAOCRDQWLHZES-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|