About 4-(oxan-2-yl)-1,3-thiazole
4-(oxan-2-yl)-1,3-thiazole (PubChem CID 91346575) has the molecular formula C8H11NOS
and a molecular weight of 169.25 g/mol. Its IUPAC name is 4-(oxan-2-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(oxan-2-yl)-1,3-thiazole |
| PubChem CID | 91346575 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 4-(oxan-2-yl)-1,3-thiazole |
| SMILES | c1nc(C2CCCCO2)cs1 |
| InChI | InChI=1S/C8H11NOS/c1-2-4-10-8(3-1)7-5-11-6-9-7/h5-6,8H,1-4H2 |
| InChIKey | MLZUPEIYBGVGBM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(oxan-2-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxan-2-yl)-1,3-thiazole?
The IUPAC name of 4-(oxan-2-yl)-1,3-thiazole (CID 91346575) is 4-(oxan-2-yl)-1,3-thiazole.
What is the SMILES notation for 4-(oxan-2-yl)-1,3-thiazole?
The canonical SMILES for 4-(oxan-2-yl)-1,3-thiazole is c1nc(C2CCCCO2)cs1.
What is the InChIKey of 4-(oxan-2-yl)-1,3-thiazole?
The InChIKey is MLZUPEIYBGVGBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NOS/c1-2-4-10-8(3-1)7-5-11-6-9-7/h5-6,8H,1-4H2.
What are the key properties of 4-(oxan-2-yl)-1,3-thiazole?
4-(oxan-2-yl)-1,3-thiazole has a molecular weight of 169.25 g/mol, XLogP of 2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxan-2-yl)-1,3-thiazole is sourced from PubChem (CID 91346575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).