C8H11NOS — CID 91346575
4-(oxan-2-yl)-1,3-thiazole (PubChem CID 91346575) has the molecular formula C8H11NOS and a molecular weight of 169.25 g/mol. Its IUPAC name is 4-(oxan-2-yl)-1,3-thiazole.
| Compound Name | 4-(oxan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 91346575 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 4-(oxan-2-yl)-1,3-thiazole |
| SMILES | c1nc(C2CCCCO2)cs1 |
| InChI | InChI=1S/C8H11NOS/c1-2-4-10-8(3-1)7-5-11-6-9-7/h5-6,8H,1-4H2 |
| InChIKey | MLZUPEIYBGVGBM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |