C19H22O9 — CID 91346617
[(2R,3R,4R)-3,4,5-triacetyloxy-3-methyloxolan-2-yl]methyl benzoate (PubChem CID 91346617) has the molecular formula C19H22O9 and a molecular weight of 394.38 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4,5-triacetyloxy-3-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R)-3,4,5-triacetyloxy-3-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 91346617 |
| Molecular Formula | C19H22O9 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [(2R,3R,4R)-3,4,5-triacetyloxy-3-methyloxolan-2-yl]methyl benzoate |
| SMILES | CC(=O)OC1O[C@H](COC(=O)c2ccccc2)[C@@](C)(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C19H22O9/c1-11(20)25-16-18(26-12(2)21)27-15(19(16,4)28-13(3)22)10-24-17(23)14-8-6-5-7-9-14/h5-9,15-16,18H,10H2,1-4H3/t15-,16+,18?,19-/m1/s1 |
| InChIKey | LNNOPWHXJINEKT-IGEHEEHSSA-N |
| XLogP | 1.38 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|