C25H20N2 — CID 91347803
N,N-bis(2-phenylphenyl)methanimidamide (PubChem CID 91347803) has the molecular formula C25H20N2 and a molecular weight of 348.45 g/mol. Its IUPAC name is N,N-bis(2-phenylphenyl)methanimidamide.
| Compound Name | N,N-bis(2-phenylphenyl)methanimidamide |
|---|---|
| PubChem CID | 91347803 |
| Molecular Formula | C25H20N2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N,N-bis(2-phenylphenyl)methanimidamide |
| SMILES | [H]/N=C/N(c1ccccc1-c1ccccc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H20N2/c26-19-27(24-17-9-7-15-22(24)20-11-3-1-4-12-20)25-18-10-8-16-23(25)21-13-5-2-6-14-21/h1-19,26H/b26-19+ |
| InChIKey | UYEXLZXWPZPSDE-LGUFXXKBSA-N |
| XLogP | 6.77 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|