C22H35NO2 — CID 91348442
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-cyclohexyl-2-methylidenehexane-1,6-dione (PubChem CID 91348442) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-cyclohexyl-2-methylidenehexane-1,6-dione.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-cyclohexyl-2-methylidenehexane-1,6-dione |
|---|---|
| PubChem CID | 91348442 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-cyclohexyl-2-methylidenehexane-1,6-dione |
| SMILES | C=C(CCCC(=O)C1CCCCC1)C(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C22H35NO2/c1-17(9-7-15-21(24)19-11-3-2-4-12-19)22(25)23-16-8-13-18-10-5-6-14-20(18)23/h18-20H,1-16H2 |
| InChIKey | SMYKDZHHPBQOSO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|