C13H18FN3O4 — CID 91349371
4-amino-5-but-1-enyl-1-[3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 91349371) has the molecular formula C13H18FN3O4 and a molecular weight of 299.30 g/mol. Its IUPAC name is 4-amino-5-but-1-enyl-1-[3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-5-but-1-enyl-1-[3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 91349371 |
| Molecular Formula | C13H18FN3O4 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 4-amino-5-but-1-enyl-1-[3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | CCC=Cc1cn(C2OC(CO)C(O)C2F)c(=O)nc1N |
| InChI | InChI=1S/C13H18FN3O4/c1-2-3-4-7-5-17(13(20)16-11(7)15)12-9(14)10(19)8(6-18)21-12/h3-5,8-10,12,18-19H,2,6H2,1H3,(H2,15,16,20) |
| InChIKey | PPUJXXBBSSXREF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |