C23H34O8 — CID 91350098
[(3S,4R,6S)-3,4-diacetyloxy-6-(1-adamantyloxy)-5-methyloxan-2-yl]methyl acetate (PubChem CID 91350098) has the molecular formula C23H34O8 and a molecular weight of 438.52 g/mol. Its IUPAC name is [(3S,4R,6S)-3,4-diacetyloxy-6-(1-adamantyloxy)-5-methyloxan-2-yl]methyl acetate.
| Compound Name | [(3S,4R,6S)-3,4-diacetyloxy-6-(1-adamantyloxy)-5-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91350098 |
| Molecular Formula | C23H34O8 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | [(3S,4R,6S)-3,4-diacetyloxy-6-(1-adamantyloxy)-5-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](OC23CC4CC(CC(C4)C2)C3)C(C)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H34O8/c1-12-20(28-14(3)25)21(29-15(4)26)19(11-27-13(2)24)30-22(12)31-23-8-16-5-17(9-23)7-18(6-16)10-23/h12,16-22H,5-11H2,1-4H3/t12?,16?,17?,18?,19?,20-,21-,22+,23?/m1/s1 |
| InChIKey | HTJVRJISLBGVDU-IHBKWKJHSA-N |
| XLogP | 2.76 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|