C13H22O — CID 91350727
(2,8-diethylcycloocta-1,7-dien-1-yl)methanol (PubChem CID 91350727) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (2,8-diethylcycloocta-1,7-dien-1-yl)methanol.
| Compound Name | (2,8-diethylcycloocta-1,7-dien-1-yl)methanol |
|---|---|
| PubChem CID | 91350727 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (2,8-diethylcycloocta-1,7-dien-1-yl)methanol |
| SMILES | CCC1=CCCCCC(CC)=C1CO |
| InChI | InChI=1S/C13H22O/c1-3-11-8-6-5-7-9-12(4-2)13(11)10-14/h8,14H,3-7,9-10H2,1-2H3 |
| InChIKey | VQWCYVKQUFWALY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |