C20H15ClN2O2 — CID 91351475
3-(9-chloro-6-oxo-2,5-dihydro-1H-phenanthridin-4-yl)benzamide (PubChem CID 91351475) has the molecular formula C20H15ClN2O2 and a molecular weight of 350.81 g/mol. Its IUPAC name is 3-(9-chloro-6-oxo-2,5-dihydro-1H-phenanthridin-4-yl)benzamide.
| Compound Name | 3-(9-chloro-6-oxo-2,5-dihydro-1H-phenanthridin-4-yl)benzamide |
|---|---|
| PubChem CID | 91351475 |
| Molecular Formula | C20H15ClN2O2 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 3-(9-chloro-6-oxo-2,5-dihydro-1H-phenanthridin-4-yl)benzamide |
| SMILES | NC(=O)c1cccc(C2=CCCc3c2[nH]c(=O)c2ccc(Cl)cc32)c1 |
| InChI | InChI=1S/C20H15ClN2O2/c21-13-7-8-16-17(10-13)15-6-2-5-14(18(15)23-20(16)25)11-3-1-4-12(9-11)19(22)24/h1,3-5,7-10H,2,6H2,(H2,22,24)(H,23,25) |
| InChIKey | FGQSJPDAIRLHEH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |