C37H44BBrClN2O5S+ — CID 91351534
CID 91351534 (PubChem CID 91351534) has the molecular formula C37H44BBrClN2O5S+ and a molecular weight of 755.00 g/mol.
| Compound Name | CID 91351534 |
|---|---|
| PubChem CID | 91351534 |
| Molecular Formula | C37H44BBrClN2O5S+ |
| Molecular Weight | 755.00 g/mol |
| Exact Mass | 753.19 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)C(C)(C)C(=CC=C1CCCC(C=CC3=[N+](CCCOS(=O)(=O)O)c4ccc(Br)cc4C3(C)C)=C1Cl)N2CCCOC |
| InChI | InChI=1S/C37H43BBrClN2O5S/c1-36(2)29-23-27(38)13-15-31(29)41(19-7-21-46-5)33(36)17-11-25-9-6-10-26(35(25)40)12-18-34-37(3,4)30-24-28(39)14-16-32(30)42(34)20-8-22-47-48(43,44)45/h11-18,23-24H,6-10,19-22H2,1-5H3/p+1 |
| InChIKey | HGAURAJRTUUUJM-UHFFFAOYSA-O |
| XLogP | 7.71 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.00 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|