About tert-butyl 2-[2-(tert-butyl-dimethyl-methylidene-λ6-sulfanyl)oxy-4-(hydroxymethyl)cyclopentyl]acetate
tert-butyl 2-[2-(tert-butyl-dimethyl-methylidene-λ6-sulfanyl)oxy-4-(hydroxymethyl)cyclopentyl]acetate (PubChem CID 91353066) has the molecular formula C19H38O4S
and a molecular weight of 362.58 g/mol. Its IUPAC name is tert-butyl 2-[2-(tert-butyl-dimethyl-methylidene-λ6-sulfanyl)oxy-4-(hydroxymethyl)cyclopentyl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[2-(tert-butyl-dimethyl-methylidene-λ6-sulfanyl)oxy-4-(hydroxymethyl)cyclopentyl]acetate |
| PubChem CID | 91353066 |
| Molecular Formula | C19H38O4S |
| Molecular Weight | 362.58 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | tert-butyl 2-[2-(tert-butyl-dimethyl-methylidene-λ6-sulfanyl)oxy-4-(hydroxymethyl)cyclopentyl]acetate |
| SMILES | C=S(C)(C)(OC1CC(CO)CC1CC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H38O4S/c1-18(2,3)22-17(21)12-15-10-14(13-20)11-16(15)23-24(7,8,9)19(4,5)6/h14-16,20H,7,10-13H2,1-6,8-9H3 |
| InChIKey | UQWYZVWIFWNISN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[2-(tert-butyl-dimethyl-methylidene-λ6-sulfanyl)oxy-4-(hydroxymethyl)cyclopentyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[2-(tert-butyl-dimethyl-methylidene-λ6-sulfanyl)oxy-4-(hydroxymethyl)cyclopentyl]acetate?
The IUPAC name of tert-butyl 2-[2-(tert-butyl-dimethyl-methylidene-λ6-sulfanyl)oxy-4-(hydroxymethyl)cyclopentyl]acetate (CID 91353066) is tert-butyl 2-[2-(tert-butyl-dimethyl-methylidene-λ6-sulfanyl)oxy-4-(hydroxymethyl)cyclopentyl]acetate.
What is the SMILES notation for tert-butyl 2-[2-(tert-butyl-dimethyl-methylidene-λ6-sulfanyl)oxy-4-(hydroxymethyl)cyclopentyl]acetate?
The canonical SMILES for tert-butyl 2-[2-(tert-butyl-dimethyl-methylidene-λ6-sulfanyl)oxy-4-(hydroxymethyl)cyclopentyl]acetate is C=S(C)(C)(OC1CC(CO)CC1CC(=O)OC(C)(C)C)C(C)(C)C.
What is the InChIKey of tert-butyl 2-[2-(tert-butyl-dimethyl-methylidene-λ6-sulfanyl)oxy-4-(hydroxymethyl)cyclopentyl]acetate?
The InChIKey is UQWYZVWIFWNISN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O4S/c1-18(2,3)22-17(21)12-15-10-14(13-20)11-16(15)23-24(7,8,9)19(4,5)6/h14-16,20H,7,10-13H2,1-6,8-9H3.
What are the key properties of tert-butyl 2-[2-(tert-butyl-dimethyl-methylidene-λ6-sulfanyl)oxy-4-(hydroxymethyl)cyclopentyl]acetate?
tert-butyl 2-[2-(tert-butyl-dimethyl-methylidene-λ6-sulfanyl)oxy-4-(hydroxymethyl)cyclopentyl]acetate has a molecular weight of 362.58 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[2-(tert-butyl-dimethyl-methylidene-λ6-sulfanyl)oxy-4-(hydroxymethyl)cyclopentyl]acetate is sourced from PubChem (CID 91353066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).