About tert-butyl 2-[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-4-formylcyclopentyl]acetate
tert-butyl 2-[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-4-formylcyclopentyl]acetate (PubChem CID 91076623) has the molecular formula C18H34O4S
and a molecular weight of 346.53 g/mol. Its IUPAC name is tert-butyl 2-[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-4-formylcyclopentyl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-4-formylcyclopentyl]acetate |
| PubChem CID | 91076623 |
| Molecular Formula | C18H34O4S |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | tert-butyl 2-[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-4-formylcyclopentyl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CC(C=O)CC1OS(C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O4S/c1-17(2,3)21-16(20)11-14-9-13(12-19)10-15(14)22-23(7,8)18(4,5)6/h12-15H,9-11H2,1-8H3 |
| InChIKey | KGFSHPUJSQPYBC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-4-formylcyclopentyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-4-formylcyclopentyl]acetate?
The IUPAC name of tert-butyl 2-[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-4-formylcyclopentyl]acetate (CID 91076623) is tert-butyl 2-[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-4-formylcyclopentyl]acetate.
What is the SMILES notation for tert-butyl 2-[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-4-formylcyclopentyl]acetate?
The canonical SMILES for tert-butyl 2-[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-4-formylcyclopentyl]acetate is CC(C)(C)OC(=O)CC1CC(C=O)CC1OS(C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl 2-[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-4-formylcyclopentyl]acetate?
The InChIKey is KGFSHPUJSQPYBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O4S/c1-17(2,3)21-16(20)11-14-9-13(12-19)10-15(14)22-23(7,8)18(4,5)6/h12-15H,9-11H2,1-8H3.
What are the key properties of tert-butyl 2-[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-4-formylcyclopentyl]acetate?
tert-butyl 2-[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-4-formylcyclopentyl]acetate has a molecular weight of 346.53 g/mol, XLogP of 4.11, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[2-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-4-formylcyclopentyl]acetate is sourced from PubChem (CID 91076623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).