C19H34O4 — CID 90899241
tert-butyl 2-[4-formyl-2-(2,3,3-trimethylbutan-2-yloxy)cyclopentyl]acetate (PubChem CID 90899241) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is tert-butyl 2-[4-formyl-2-(2,3,3-trimethylbutan-2-yloxy)cyclopentyl]acetate.
| Compound Name | tert-butyl 2-[4-formyl-2-(2,3,3-trimethylbutan-2-yloxy)cyclopentyl]acetate |
|---|---|
| PubChem CID | 90899241 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | tert-butyl 2-[4-formyl-2-(2,3,3-trimethylbutan-2-yloxy)cyclopentyl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CC(C=O)CC1OC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O4/c1-17(2,3)19(7,8)22-15-10-13(12-20)9-14(15)11-16(21)23-18(4,5)6/h12-15H,9-11H2,1-8H3 |
| InChIKey | HPYTVMOQGKWJHI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|