C16H11ClFN3 — CID 91354782
2-(2-chloro-6-fluorophenyl)-5-[(3E)-hexa-1,3,5-trien-3-yl]-1H-imidazole-4-carbonitrile (PubChem CID 91354782) has the molecular formula C16H11ClFN3 and a molecular weight of 299.74 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-5-[(3E)-hexa-1,3,5-trien-3-yl]-1H-imidazole-4-carbonitrile.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-5-[(3E)-hexa-1,3,5-trien-3-yl]-1H-imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 91354782 |
| Molecular Formula | C16H11ClFN3 |
| Molecular Weight | 299.74 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-5-[(3E)-hexa-1,3,5-trien-3-yl]-1H-imidazole-4-carbonitrile |
| SMILES | C=C/C=C(\C=C)c1[nH]c(-c2c(F)cccc2Cl)nc1C#N |
| InChI | InChI=1S/C16H11ClFN3/c1-3-6-10(4-2)15-13(9-19)20-16(21-15)14-11(17)7-5-8-12(14)18/h3-8H,1-2H2,(H,20,21)/b10-6+ |
| InChIKey | GMXLOEZTEDOJSD-UXBLZVDNSA-N |
| XLogP | 4.50 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.74 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|