C15H22 — CID 91356849
3-methyl-4-prop-1-enylundeca-1,7-dien-5-yne (PubChem CID 91356849) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 3-methyl-4-prop-1-enylundeca-1,7-dien-5-yne.
| Compound Name | 3-methyl-4-prop-1-enylundeca-1,7-dien-5-yne |
|---|---|
| PubChem CID | 91356849 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 3-methyl-4-prop-1-enylundeca-1,7-dien-5-yne |
| SMILES | C=CC(C)C(C#CC=CCCC)C=CC |
| InChI | InChI=1S/C15H22/c1-5-8-9-10-11-13-15(12-6-2)14(4)7-3/h6-7,9-10,12,14-15H,3,5,8H2,1-2,4H3 |
| InChIKey | VMMGPZPNCFIPKI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|