C16H25NO2 — CID 91357766
4-(2-deuterioethyl)-N-[(3S)-2-oxopentan-3-yl]benzamide;ethane (PubChem CID 91357766) has the molecular formula C16H25NO2 and a molecular weight of 264.39 g/mol. Its IUPAC name is 4-(2-deuterioethyl)-N-[(3S)-2-oxopentan-3-yl]benzamide;ethane.
| Compound Name | 4-(2-deuterioethyl)-N-[(3S)-2-oxopentan-3-yl]benzamide;ethane |
|---|---|
| PubChem CID | 91357766 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 4-(2-deuterioethyl)-N-[(3S)-2-oxopentan-3-yl]benzamide;ethane |
| SMILES | CC.[2H]CCc1ccc(C(=O)N[C@@H](CC)C(C)=O)cc1 |
| InChI | InChI=1S/C14H19NO2.C2H6/c1-4-11-6-8-12(9-7-11)14(17)15-13(5-2)10(3)16;1-2/h6-9,13H,4-5H2,1-3H3,(H,15,17);1-2H3/t13-;/m0./s1/i1D; |
| InChIKey | JLYBYJMUGMHFEN-DRZNASBISA-N |
| XLogP | 3.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |