C3H9N3O5S2 — CID 91357985
1-methyl-3-methylsulfonyl-1-sulfamoylurea (PubChem CID 91357985) has the molecular formula C3H9N3O5S2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-methyl-3-methylsulfonyl-1-sulfamoylurea.
| Compound Name | 1-methyl-3-methylsulfonyl-1-sulfamoylurea |
|---|---|
| PubChem CID | 91357985 |
| Molecular Formula | C3H9N3O5S2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | 1-methyl-3-methylsulfonyl-1-sulfamoylurea |
| SMILES | CN(C(=O)NS(C)(=O)=O)S(N)(=O)=O |
| InChI | InChI=1S/C3H9N3O5S2/c1-6(13(4,10)11)3(7)5-12(2,8)9/h1-2H3,(H,5,7)(H2,4,10,11) |
| InChIKey | IUZAFLRGLJBWGQ-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |