C32H27N7O4+2 — CID 91358376
ethyl 4-methyl-3-oxo-2-phenyl-1,2,4-benzotriazin-4-ium-7-carboxylate;7-isocyano-4-methyl-2-phenyl-1,2,4-benzotriazin-4-ium-3-one (PubChem CID 91358376) has the molecular formula C32H27N7O4+2 and a molecular weight of 573.61 g/mol. Its IUPAC name is ethyl 4-methyl-3-oxo-2-phenyl-1,2,4-benzotriazin-4-ium-7-carboxylate;7-isocyano-4-methyl-2-phenyl-1,2,4-benzotriazin-4-ium-3-one.
| Compound Name | ethyl 4-methyl-3-oxo-2-phenyl-1,2,4-benzotriazin-4-ium-7-carboxylate;7-isocyano-4-methyl-2-phenyl-1,2,4-benzotriazin-4-ium-3-one |
|---|---|
| PubChem CID | 91358376 |
| Molecular Formula | C32H27N7O4+2 |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | ethyl 4-methyl-3-oxo-2-phenyl-1,2,4-benzotriazin-4-ium-7-carboxylate;7-isocyano-4-methyl-2-phenyl-1,2,4-benzotriazin-4-ium-3-one |
| SMILES | CCOC(=O)c1ccc2c(c1)nn(-c1ccccc1)c(=O)[n+]2C.[C-]#[N+]c1ccc2c(c1)nn(-c1ccccc1)c(=O)[n+]2C |
| InChI | InChI=1S/C17H16N3O3.C15H11N4O/c1-3-23-16(21)12-9-10-15-14(11-12)18-20(17(22)19(15)2)13-7-5-4-6-8-13;1-16-11-8-9-14-13(10-11)17-19(15(20)18(14)2)12-6-4-3-5-7-12/h4-11H,3H2,1-2H3;3-10H,2H3/q2*+1 |
| InChIKey | KKZWZCIHPKWZRU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 108.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|