C22H23FN4O6S — CID 91358612
8-(4-fluorophenyl)sulfonyl-N-[1-(4-nitrophenyl)ethyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide (PubChem CID 91358612) has the molecular formula C22H23FN4O6S and a molecular weight of 490.51 g/mol. Its IUPAC name is 8-(4-fluorophenyl)sulfonyl-N-[1-(4-nitrophenyl)ethyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide.
| Compound Name | 8-(4-fluorophenyl)sulfonyl-N-[1-(4-nitrophenyl)ethyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 91358612 |
| Molecular Formula | C22H23FN4O6S |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 8-(4-fluorophenyl)sulfonyl-N-[1-(4-nitrophenyl)ethyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-3-carboxamide |
| SMILES | CC(NC(=O)C1=CC2(CCN(S(=O)(=O)c3ccc(F)cc3)CC2)ON1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H23FN4O6S/c1-15(16-2-6-18(7-3-16)27(29)30)24-21(28)20-14-22(33-25-20)10-12-26(13-11-22)34(31,32)19-8-4-17(23)5-9-19/h2-9,14-15,25H,10-13H2,1H3,(H,24,28) |
| InChIKey | PJHPRGKXBCOBEG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|