C20H20FNO2 — CID 91358678
3-(3-ethyl-1H-pyrrol-2-yl)-3-[5-[(4-fluorophenyl)methyl]furan-2-yl]propanal (PubChem CID 91358678) has the molecular formula C20H20FNO2 and a molecular weight of 325.38 g/mol. Its IUPAC name is 3-(3-ethyl-1H-pyrrol-2-yl)-3-[5-[(4-fluorophenyl)methyl]furan-2-yl]propanal.
| Compound Name | 3-(3-ethyl-1H-pyrrol-2-yl)-3-[5-[(4-fluorophenyl)methyl]furan-2-yl]propanal |
|---|---|
| PubChem CID | 91358678 |
| Molecular Formula | C20H20FNO2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 3-(3-ethyl-1H-pyrrol-2-yl)-3-[5-[(4-fluorophenyl)methyl]furan-2-yl]propanal |
| SMILES | CCc1cc[nH]c1C(CC=O)c1ccc(Cc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C20H20FNO2/c1-2-15-9-11-22-20(15)18(10-12-23)19-8-7-17(24-19)13-14-3-5-16(21)6-4-14/h3-9,11-12,18,22H,2,10,13H2,1H3 |
| InChIKey | IBJKHJSOGYIIRP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|