C23H26N3OS+ — CID 9135883
2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]-N-phenyl-N-prop-2-enylacetamide (PubChem CID 9135883) has the molecular formula C23H26N3OS+ and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]-N-phenyl-N-prop-2-enylacetamide.
| Compound Name | 2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]-N-phenyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 9135883 |
| Molecular Formula | C23H26N3OS+ |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-[(2R)-2-(1,3-benzothiazol-2-yl)piperidin-1-ium-1-yl]-N-phenyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)C[NH+]1CCCC[C@@H]1c1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C23H25N3OS/c1-2-15-26(18-10-4-3-5-11-18)22(27)17-25-16-9-8-13-20(25)23-24-19-12-6-7-14-21(19)28-23/h2-7,10-12,14,20H,1,8-9,13,15-17H2/p+1/t20-/m1/s1 |
| InChIKey | JOBNVLLCSQYIGZ-HXUWFJFHSA-O |
| XLogP | 3.63 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|