C32H66N4O2 — CID 91359656
3-[ethyl-[2-[ethyl-[3-[(2-ethyl-2,4,4-trimethylpentyl)amino]-3-oxopropyl]amino]ethyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide (PubChem CID 91359656) has the molecular formula C32H66N4O2 and a molecular weight of 538.91 g/mol. Its IUPAC name is 3-[ethyl-[2-[ethyl-[3-[(2-ethyl-2,4,4-trimethylpentyl)amino]-3-oxopropyl]amino]ethyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide.
| Compound Name | 3-[ethyl-[2-[ethyl-[3-[(2-ethyl-2,4,4-trimethylpentyl)amino]-3-oxopropyl]amino]ethyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide |
|---|---|
| PubChem CID | 91359656 |
| Molecular Formula | C32H66N4O2 |
| Molecular Weight | 538.91 g/mol |
| Exact Mass | 538.52 |
| IUPAC Name | 3-[ethyl-[2-[ethyl-[3-[(2-ethyl-2,4,4-trimethylpentyl)amino]-3-oxopropyl]amino]ethyl]amino]-N-(2,2,4,4-tetramethylhexyl)propanamide |
| SMILES | CCN(CCC(=O)NCC(C)(C)CC(C)(C)CC)CCN(CC)CCC(=O)NCC(C)(CC)CC(C)(C)C |
| InChI | InChI=1S/C32H66N4O2/c1-13-30(8,9)24-31(10,11)25-33-27(37)17-19-35(15-3)21-22-36(16-4)20-18-28(38)34-26-32(12,14-2)23-29(5,6)7/h13-26H2,1-12H3,(H,33,37)(H,34,38) |
| InChIKey | HGTKCAQOUYWFQM-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.91 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |