C25H22BrN4O3S2- — CID 91364123
3-benzyl-4-[5-(bromomethyl)-2-(2-phenylethylcarbamoyl)-N-sulfinatoanilino]-1,2,5-thiadiazole (PubChem CID 91364123) has the molecular formula C25H22BrN4O3S2- and a molecular weight of 570.51 g/mol. Its IUPAC name is 3-benzyl-4-[5-(bromomethyl)-2-(2-phenylethylcarbamoyl)-N-sulfinatoanilino]-1,2,5-thiadiazole.
| Compound Name | 3-benzyl-4-[5-(bromomethyl)-2-(2-phenylethylcarbamoyl)-N-sulfinatoanilino]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 91364123 |
| Molecular Formula | C25H22BrN4O3S2- |
| Molecular Weight | 570.51 g/mol |
| Exact Mass | 569.03 |
| IUPAC Name | 3-benzyl-4-[5-(bromomethyl)-2-(2-phenylethylcarbamoyl)-N-sulfinatoanilino]-1,2,5-thiadiazole |
| SMILES | O=C(NCCc1ccccc1)c1ccc(CBr)cc1N(c1nsnc1Cc1ccccc1)S(=O)[O-] |
| InChI | InChI=1S/C25H23BrN4O3S2/c26-17-20-11-12-21(25(31)27-14-13-18-7-3-1-4-8-18)23(16-20)30(35(32)33)24-22(28-34-29-24)15-19-9-5-2-6-10-19/h1-12,16H,13-15,17H2,(H,27,31)(H,32,33)/p-1 |
| InChIKey | PRPBGNZSDBYHNA-UHFFFAOYSA-M |
| XLogP | 4.93 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|