C23H24N4O4 — CID 91364251
N-[(3S)-5-methyl-2-oxo-1-(5-oxo-3-pyridin-2-yl-1,2,4-oxadiazol-4-yl)hexan-3-yl]-3-phenylprop-2-enamide (PubChem CID 91364251) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[(3S)-5-methyl-2-oxo-1-(5-oxo-3-pyridin-2-yl-1,2,4-oxadiazol-4-yl)hexan-3-yl]-3-phenylprop-2-enamide.
| Compound Name | N-[(3S)-5-methyl-2-oxo-1-(5-oxo-3-pyridin-2-yl-1,2,4-oxadiazol-4-yl)hexan-3-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 91364251 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[(3S)-5-methyl-2-oxo-1-(5-oxo-3-pyridin-2-yl-1,2,4-oxadiazol-4-yl)hexan-3-yl]-3-phenylprop-2-enamide |
| SMILES | CC(C)C[C@H](NC(=O)C=Cc1ccccc1)C(=O)Cn1c(-c2ccccn2)noc1=O |
| InChI | InChI=1S/C23H24N4O4/c1-16(2)14-19(25-21(29)12-11-17-8-4-3-5-9-17)20(28)15-27-22(26-31-23(27)30)18-10-6-7-13-24-18/h3-13,16,19H,14-15H2,1-2H3,(H,25,29)/t19-/m0/s1 |
| InChIKey | WVBPSOVLVNKCGX-IBGZPJMESA-N |
| XLogP | 2.71 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|