C19H30N6O2 — CID 91365054
1-(4-hydroxypiperidin-1-yl)-7-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]heptan-1-one (PubChem CID 91365054) has the molecular formula C19H30N6O2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-(4-hydroxypiperidin-1-yl)-7-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]heptan-1-one.
| Compound Name | 1-(4-hydroxypiperidin-1-yl)-7-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]heptan-1-one |
|---|---|
| PubChem CID | 91365054 |
| Molecular Formula | C19H30N6O2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 1-(4-hydroxypiperidin-1-yl)-7-[2-methyl-4-(methylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]heptan-1-one |
| SMILES | CNc1nc(C)nc2c(CCCCCCC(=O)N3CCC(O)CC3)cnn12 |
| InChI | InChI=1S/C19H30N6O2/c1-14-22-18-15(13-21-25(18)19(20-2)23-14)7-5-3-4-6-8-17(27)24-11-9-16(26)10-12-24/h13,16,26H,3-12H2,1-2H3,(H,20,22,23) |
| InChIKey | BQUGBPBHJPHGRZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|