C11H20N2 — CID 91365768
N,N-diethyl-2-(2-methylpyrrol-2-yl)ethanamine (PubChem CID 91365768) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is N,N-diethyl-2-(2-methylpyrrol-2-yl)ethanamine.
| Compound Name | N,N-diethyl-2-(2-methylpyrrol-2-yl)ethanamine |
|---|---|
| PubChem CID | 91365768 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N,N-diethyl-2-(2-methylpyrrol-2-yl)ethanamine |
| SMILES | CCN(CC)CCC1(C)C=CC=N1 |
| InChI | InChI=1S/C11H20N2/c1-4-13(5-2)10-8-11(3)7-6-9-12-11/h6-7,9H,4-5,8,10H2,1-3H3 |
| InChIKey | VXWMCDZLEKZBDA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |