C12H21N2+ — CID 146657855
1,2,2-trimethyl-4-pyrrolidin-1-yl-3H-pyridin-1-ium (PubChem CID 146657855) has the molecular formula C12H21N2+ and a molecular weight of 193.31 g/mol. Its IUPAC name is 1,2,2-trimethyl-4-pyrrolidin-1-yl-3H-pyridin-1-ium.
| Compound Name | 1,2,2-trimethyl-4-pyrrolidin-1-yl-3H-pyridin-1-ium |
|---|---|
| PubChem CID | 146657855 |
| Molecular Formula | C12H21N2+ |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.17 |
| IUPAC Name | 1,2,2-trimethyl-4-pyrrolidin-1-yl-3H-pyridin-1-ium |
| SMILES | C[N+]1=CC=C(N2CCCC2)CC1(C)C |
| InChI | InChI=1S/C12H21N2/c1-12(2)10-11(6-9-13(12)3)14-7-4-5-8-14/h6,9H,4-5,7-8,10H2,1-3H3/q+1 |
| InChIKey | QVHRHGANHOMUOJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|