C13H23N2+ — CID 156630786
1,2,2-trimethyl-4-piperidin-1-yl-3H-pyridin-1-ium (PubChem CID 156630786) has the molecular formula C13H23N2+ and a molecular weight of 207.34 g/mol. Its IUPAC name is 1,2,2-trimethyl-4-piperidin-1-yl-3H-pyridin-1-ium.
| Compound Name | 1,2,2-trimethyl-4-piperidin-1-yl-3H-pyridin-1-ium |
|---|---|
| PubChem CID | 156630786 |
| Molecular Formula | C13H23N2+ |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.19 |
| IUPAC Name | 1,2,2-trimethyl-4-piperidin-1-yl-3H-pyridin-1-ium |
| SMILES | C[N+]1=CC=C(N2CCCCC2)CC1(C)C |
| InChI | InChI=1S/C13H23N2/c1-13(2)11-12(7-10-14(13)3)15-8-5-4-6-9-15/h7,10H,4-6,8-9,11H2,1-3H3/q+1 |
| InChIKey | OLCZHCQIABKDKH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|