C10H19N3 — CID 143506326
(Z)-1-(1-ethylpiperidin-4-yl)-3-iminoprop-1-en-1-amine (PubChem CID 143506326) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is (Z)-1-(1-ethylpiperidin-4-yl)-3-iminoprop-1-en-1-amine.
| Compound Name | (Z)-1-(1-ethylpiperidin-4-yl)-3-iminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 143506326 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | (Z)-1-(1-ethylpiperidin-4-yl)-3-iminoprop-1-en-1-amine |
| SMILES | [H]/N=C/C=C(\N)C1CCN(CC)CC1 |
| InChI | InChI=1S/C10H19N3/c1-2-13-7-4-9(5-8-13)10(12)3-6-11/h3,6,9,11H,2,4-5,7-8,12H2,1H3/b10-3-,11-6+ |
| InChIKey | XDTGRCLUNAYQQJ-KAGHAQNVSA-N |
| XLogP | 1.21 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|