C14H27N3 — CID 144740178
(E)-N-methyl-4-methylimino-4-piperidin-4-ylbut-2-en-2-amine;prop-1-ene (PubChem CID 144740178) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is (E)-N-methyl-4-methylimino-4-piperidin-4-ylbut-2-en-2-amine;prop-1-ene.
| Compound Name | (E)-N-methyl-4-methylimino-4-piperidin-4-ylbut-2-en-2-amine;prop-1-ene |
|---|---|
| PubChem CID | 144740178 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | (E)-N-methyl-4-methylimino-4-piperidin-4-ylbut-2-en-2-amine;prop-1-ene |
| SMILES | C/N=C(\C=C(/C)NC)C1CCNCC1.C=CC |
| InChI | InChI=1S/C11H21N3.C3H6/c1-9(12-2)8-11(13-3)10-4-6-14-7-5-10;1-3-2/h8,10,12,14H,4-7H2,1-3H3;3H,1H2,2H3/b9-8+,13-11+; |
| InChIKey | BFMNBFIEEYAINO-HKKJTPCJSA-N |
| XLogP | 2.37 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|