C14H20N2 — CID 91342279
4-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2,8-diazaspiro[4.5]deca-1,3-diene (PubChem CID 91342279) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2,8-diazaspiro[4.5]deca-1,3-diene.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2,8-diazaspiro[4.5]deca-1,3-diene |
|---|---|
| PubChem CID | 91342279 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-1,3-dimethyl-2,8-diazaspiro[4.5]deca-1,3-diene |
| SMILES | C=C/C=C\C1=C(C)N=C(C)C12CCNCC2 |
| InChI | InChI=1S/C14H20N2/c1-4-5-6-13-11(2)16-12(3)14(13)7-9-15-10-8-14/h4-6,15H,1,7-10H2,2-3H3/b6-5- |
| InChIKey | XXBISWUQBODDSV-WAYWQWQTSA-N |
| XLogP | 2.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|