C13H22N2 — CID 143703557
5-piperidin-1-yl-2,3-dihydropyridine;prop-1-ene (PubChem CID 143703557) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 5-piperidin-1-yl-2,3-dihydropyridine;prop-1-ene.
| Compound Name | 5-piperidin-1-yl-2,3-dihydropyridine;prop-1-ene |
|---|---|
| PubChem CID | 143703557 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 5-piperidin-1-yl-2,3-dihydropyridine;prop-1-ene |
| SMILES | C1=NCCC=C1N1CCCCC1.C=CC |
| InChI | InChI=1S/C10H16N2.C3H6/c1-2-7-12(8-3-1)10-5-4-6-11-9-10;1-3-2/h5,9H,1-4,6-8H2;3H,1H2,2H3 |
| InChIKey | SGMOIPHSNISKIJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|