C10H17N3 — CID 123139522
1-(2,3-dihydropyridin-4-yl)-4-methylpiperazine (PubChem CID 123139522) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-(2,3-dihydropyridin-4-yl)-4-methylpiperazine.
| Compound Name | 1-(2,3-dihydropyridin-4-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 123139522 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-(2,3-dihydropyridin-4-yl)-4-methylpiperazine |
| SMILES | CN1CCN(C2=CC=NCC2)CC1 |
| InChI | InChI=1S/C10H17N3/c1-12-6-8-13(9-7-12)10-2-4-11-5-3-10/h2,4H,3,5-9H2,1H3 |
| InChIKey | RJEXJABRVOWPKO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |