C11H20N4 — CID 163687771
4-(4-ethylpiperazin-1-yl)-2,3-dihydropyridin-3-amine (PubChem CID 163687771) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-2,3-dihydropyridin-3-amine.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-2,3-dihydropyridin-3-amine |
|---|---|
| PubChem CID | 163687771 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-2,3-dihydropyridin-3-amine |
| SMILES | CCN1CCN(C2=CC=NCC2N)CC1 |
| InChI | InChI=1S/C11H20N4/c1-2-14-5-7-15(8-6-14)11-3-4-13-9-10(11)12/h3-4,10H,2,5-9,12H2,1H3 |
| InChIKey | JQIJMHUDWBDBGC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |