C10H17N3 — CID 144594832
N,1-dimethyl-5-(prop-2-enylideneamino)-3,6-dihydro-2H-pyridin-4-amine (PubChem CID 144594832) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is N,1-dimethyl-5-(prop-2-enylideneamino)-3,6-dihydro-2H-pyridin-4-amine.
| Compound Name | N,1-dimethyl-5-(prop-2-enylideneamino)-3,6-dihydro-2H-pyridin-4-amine |
|---|---|
| PubChem CID | 144594832 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | N,1-dimethyl-5-(prop-2-enylideneamino)-3,6-dihydro-2H-pyridin-4-amine |
| SMILES | C=C/C=N/C1=C(NC)CCN(C)C1 |
| InChI | InChI=1S/C10H17N3/c1-4-6-12-10-8-13(3)7-5-9(10)11-2/h4,6,11H,1,5,7-8H2,2-3H3/b12-6+ |
| InChIKey | FWZDBULHJYEEQA-WUXMJOGZSA-N |
| XLogP | 1.01 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|