C10H18N3+ — CID 123705077
1,7-dimethyl-3,4,5,5a,6,8-hexahydropyrido[4,3-e][1,4]diazepin-1-ium (PubChem CID 123705077) has the molecular formula C10H18N3+ and a molecular weight of 180.28 g/mol. Its IUPAC name is 1,7-dimethyl-3,4,5,5a,6,8-hexahydropyrido[4,3-e][1,4]diazepin-1-ium.
| Compound Name | 1,7-dimethyl-3,4,5,5a,6,8-hexahydropyrido[4,3-e][1,4]diazepin-1-ium |
|---|---|
| PubChem CID | 123705077 |
| Molecular Formula | C10H18N3+ |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 1,7-dimethyl-3,4,5,5a,6,8-hexahydropyrido[4,3-e][1,4]diazepin-1-ium |
| SMILES | CN1CC=C2C(CNCC=[N+]2C)C1 |
| InChI | InChI=1S/C10H18N3/c1-12-5-3-10-9(8-12)7-11-4-6-13(10)2/h3,6,9,11H,4-5,7-8H2,1-2H3/q+1 |
| InChIKey | CONKFXAJXQDECS-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|